On Target NPSR1_HUMAN 0.3542601/CHEMBL1801360
For the given ligand sinomenine, we have found in our database that, being scored 0.3542601, the most similar ligand is CHEMBL1801360. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL1801360 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1ccc2c(c1)C(CCC(=O)N1[C@@H](C)CC[C@H]1C)(c1ccc(Cl)cc1)n1ccnc1-2 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 0003c102 47801208 2010010a 10010600 20081060 40002010 02040400 21081000 80300900 100818c4 08308008 40039800 07009866 20a00000 018200a1 020d000c 00000000 0e002080 00482000 00420201 80100100 38048710 21005040 81528019 00002000 e0000001 00060100 50014080 06000284 0046080b 400c0800 00422600 |