On Target CCR5_HUMAN 0.4300518/CHEMBL368183
For the given ligand sinomenine, we have found in our database that, being scored 0.4300518, the most similar ligand is CHEMBL368183. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL368183 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | Cn1ncc(CCc2ccccc2)c1C1CCN(C[C@H]2CN([C@@H](C(=O)O)C3CCCCC3)C[C@@H]2c2ccccc2)CC1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00010004 43000608 20101180 00810610 01080080 40000012 00042020 20000201 00200880 000c09e0 08308000 5003b040 0e00800a 20a00000 80080800 0a0c200c 10000000 86000000 02482000 00220241 00000100 18310a10 07c04800 8b500414 00002000 c0000001 00120000 10000100 04000004 0006801a 00024000 00002720 |