On Target NK2R_HUMAN 0.41450778/CHEMBL504342
For the given ligand sinomenine, we have found in our database that, being scored 0.41450778, the most similar ligand is CHEMBL504342. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL504342 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1ccc(/C=C/C(=O)NC2(C(=O)N[C@H](Cc3ccccc3)C(=O)NCC3CCN(CC4CCOCC4)CC3)CCCC2)cc1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00010000 0100b208 20100108 04010700 80181000 00000000 82140080 2000040c 01a00880 004808c0 08300800 5003b000 0600800a 00012001 81000003 000c1008 20000400 02000100 0041a008 00821201 00000120 38240610 01000003 83500018 00000c00 80000000 004a2200 50010000 0c400200 0106000b 24004000 02002e00 |