On Target ADRB3_HUMAN 0.45086706/CHEMBL498305
For the given ligand sinomenine, we have found in our database that, being scored 0.45086706, the most similar ligand is CHEMBL498305. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL498305 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | O=C(O)COc1ccc2c(c1)C[C@@H](NC[C@H](O)c1cccc(Cl)c1)CC2 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 04008000 57000208 2010010a 00010600 000010a0 c0004000 06040000 20000001 00000980 000808c0 08340000 4080c800 02808006 20200080 81280001 020c0008 10000200 82000000 00082000 00020201 00000100 18200b20 06004000 89480010 00002000 80000001 00120008 10800000 04000202 0006000a 40000000 00022600 |