On Target ACM4_HUMAN 0.43225807/CHEMBL1101
For the given ligand sinomenine, we have found in our database that, being scored 0.43225807, the most similar ligand is CHEMBL1101. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL1101 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | OC(CCN1CCCCC1)(c1ccccc1)C1CC2C=CC1C2 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00000000 81000200 00100102 00010600 00080000 00004000 00000000 20000402 00000900 001808c8 08300000 50018000 00020002 00a00000 00000400 000c0008 00000000 02000020 00c02000 00002201 00000100 18000030 01008080 00500010 00200001 80202000 00404000 90000000 00000002 0106000a 64020000 00002600 |