On Target TAAR1_HUMAN 0.47894737/CHEMBL3211097
For the given ligand sinomenine, we have found in our database that, being scored 0.47894737, the most similar ligand is CHEMBL3211097. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL3211097 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | CCOc1ccc(C/C(=N/CCc2ccccc2)C2=C(O)CC(C)(C)CC2=O)cc1OCC |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 04010002 43000808 2020010a 00310e00 00881000 40000000 12040080 10002402 010008a0 20188843 08130000 40009000 8482c022 20a02081 01000401 22188088 00000800 02000022 004d2000 00220241 00000101 38010280 41008802 81400810 00200000 a4020000 40524000 80400880 0c204212 0006000a 44020000 00410400 |