On Target MC3R_HUMAN 0.40703517/CHEMBL192450
For the given ligand sinomenine, we have found in our database that, being scored 0.40703517, the most similar ligand is CHEMBL192450. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL192450 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | N=C(N)NCCC[C@H](NC(=O)Cc1ccc2c(c1)OCO2)C(=O)N1C[C@H](Cc2ccccc2)C[C@H]1C(=O)NCc1ccccc1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00010000 43803208 2010010a 04010e00 00001000 80000010 02040000 22003008 00300a80 000908c2 48300000 4003b000 0700d81a 20202001 c1000401 00348008 00000000 02000000 00082000 00020201 80040300 38258630 00000003 83500018 40000000 c0000000 40120000 b0010000 0d000312 0006000b a00c6000 00012600 |