On Target HRH3_HUMAN 0.48447204/CHEMBL4461203
For the given ligand sinomenine, we have found in our database that, being scored 0.48447204, the most similar ligand is CHEMBL4461203. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL4461203 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | CCNC(=O)[C@@H]1CC(=O)[C@@]2(C)CC[C@@H]3c4ccc(OCCCCN5CCC[C@@H]5C)cc4CC[C@H]3[C@H]12 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 04030000 43000008 2010010a 00010700 00101000 42000012 02040000 20000001 00000800 000a08c0 08300000 40019000 0480801a 20200080 11000021 00082008 00000200 02000000 02482000 00020201 00000100 18000610 01004000 00500018 00000000 80000001 00120200 10000000 00000202 01060003 00020000 00802e00 |