On Target AA1R_HUMAN 0.37696335/CHEMBL1269107
For the given ligand sinomenine, we have found in our database that, being scored 0.37696335, the most similar ligand is CHEMBL1269107. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL1269107 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | CC1=C(C2=C(C)C(=O)c3c(cc(O)c(O)c3Cc3ccccc3)C2=O)C(=O)c2cc(O)c(O)c(Cc3ccccc3)c2C1=O |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00010000 43040c08 20800103 00310200 40000001 40808003 220004c1 01000603 81000840 00980a42 08100000 40009200 04028022 20200000 00000022 2808a00c 00000004 02100000 00392080 00030a01 00400100 080202c0 0100c000 00460014 00200000 a4000001 00520000 c0800000 02000082 00020002 86000000 00410400 |