On Target CXCR3_HUMAN 0.43715847/CHEMBL3697082
For the given ligand sinomenine, we have found in our database that, being scored 0.43715847, the most similar ligand is CHEMBL3697082. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL3697082 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1cc(CN(C[C@H]2CC[C@H](C(=O)O)CC2)[C@H]2CCc3cc(Cl)ccc32)ccc1CCCN1C(=O)CCC1=O |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00038008 45001208 2010010a 10010600 00081000 00000010 06000000 22001200 00000900 000808c0 08300000 40019840 860088ee 00a01000 81000401 000e2008 00002000 02000000 02482000 00020201 00020100 18048f10 01004000 00548418 00002000 c0000000 00044000 90000000 00000302 0006800b 20060000 00822600 |