On Target CNR1_HUMAN 0.5502958/CHEMBL344623
For the given ligand sinomenine, we have found in our database that, being scored 0.5502958, the most similar ligand is CHEMBL344623. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL344623 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | CCN(CC)C(=O)CCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CC=C(C)C[C@@H]21 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 04010001 c3000018 2010010a 80110700 00081000 c2000000 42000000 20000602 00000900 001808ca 08300000 40019840 0482800a 20a00080 11000401 00082008 00800000 22008020 00482000 00022a01 00000100 18000610 01008040 00500418 00200000 c0002000 04404000 90000000 00010302 00074003 24020000 00010600 |