On Target PTAFR_HUMAN 0.41037735/CHEMBL97120
For the given ligand sinomenine, we have found in our database that, being scored 0.41037735, the most similar ligand is CHEMBL97120. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL97120 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | CCCCCC1=C(/C=C/C(=O)N[C@@H](C)CCCc2cccnc2)Cc2cc(OC)ccc21 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00080012 4304d408 2010430b 00910610 40041100 40800003 82142081 20000403 01500800 00b808c2 08340004 40018000 00028902 20210800 01000423 0004010c 20000400 02500104 00292480 00020a01 40100110 18048680 6080c001 0054001a 01240000 80000001 085a6000 d0000000 00400202 080e0003 24020000 03010600 |