On Target NPBW1_HUMAN 0.33484164/CHEMBL1940539
For the given ligand sinomenine, we have found in our database that, being scored 0.33484164, the most similar ligand is CHEMBL1940539. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL1940539 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1ccc(C2(N[C@@H]3CC[C@H](C(=O)N4CCN(c5nc6ccccc6[nH]5)CC4)[C@@H](c4ccsc4)C3)CCC2)cc1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00010002 01002208 2010090a 85010600 00141040 00004000 02040000 22001008 00000900 200808c0 09308204 40019080 0400881a 00603011 01001441 001c000c 00000000 02004000 02202008 00a24601 40000100 7e8086b0 21800821 32700018 00004800 c4000000 00320000 90000004 0800031a 0046180b 60069000 00c12e80 |