On Target GRM3_HUMAN 0.4090909/CHEMBL341457
For the given ligand sinomenine, we have found in our database that, being scored 0.4090909, the most similar ligand is CHEMBL341457. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL341457 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1cccc(CC[C@](N)(C(=O)O)C2C[C@@H]2C(=O)O)c1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00030000 43000208 2000010a 00010600 00181000 40000000 02000000 00000000 00000800 000a08c0 08100000 4001b000 0400803a 23a00000 01000001 00080008 00000000 02000000 00482000 00020201 00000100 18000a00 03000000 00400010 00000000 80000000 00000000 00000000 00000202 0006000a 00020000 00400400 |