On Target DRD3_HUMAN 0.5123457/CHEMBL170976
For the given ligand sinomenine, we have found in our database that, being scored 0.5123457, the most similar ligand is CHEMBL170976. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL170976 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | CCCN1CCC[C@@H]2c3cc4c(cc3CC[C@H]21)CCO4 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 04001000 43000208 2010010a 00010600 00001061 c2000002 02040000 20000241 00100980 000808c0 08300000 50818800 00800002 20200080 01040021 020c2018 08000200 02000000 04082000 00020201 00000100 18200010 01004000 81500010 00000000 80000001 00120000 10800004 04000302 0006000a 00020000 00002600 |