On Target ADRB1_HUMAN 0.44067797/CHEMBL498531
For the given ligand sinomenine, we have found in our database that, being scored 0.44067797, the most similar ligand is CHEMBL498531. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL498531 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | O=C(O)c1cccc(Oc2ccc3c(c2)C[C@@H](NC[C@H](O)c2cccc(Cl)c2)CCC3)c1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00008000 5f000808 2010010a 00010600 000010a0 c0004002 06040000 20000001 00100980 000808c0 08300000 40818800 02008006 20200000 81084025 20080008 11000200 02000000 00082000 00020201 00400100 18220b20 02004000 81580014 00002000 80000001 00120000 10200000 04000282 00060002 c0020400 00022600 |