On Target 5HT1E_HUMAN 0.32579187/CHEMBL137781
For the given ligand sinomenine, we have found in our database that, being scored 0.32579187, the most similar ligand is CHEMBL137781. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL137781 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | C[C@H]1C[C@@H](C)N1C(=O)[C@@H]1C=C2c3cccc4[nH]cc(c34)CC2N(C)C1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00000012 2910dc00 01900302 41910610 00041100 00000000 800820c0 20000402 004008c0 001909ea 08300004 41009000 98028902 00610800 00000043 000e020c 20000400 02000144 00220412 00000201 40000500 1a248608 20808000 91400018 01243000 80000000 08482048 d0000000 04404000 00260c13 24040200 02012620 |