On Target AGTR2_HUMAN 0.47761193/CHEMBL154057
For the given ligand sinomenine, we have found in our database that, being scored 0.47761193, the most similar ligand is CHEMBL154057. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL154057 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1ccc2c(c1OCc1ccccc1)CC(C(=O)O)N(C(=O)C(c1ccccc1)C1CCCC1)C2 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 04018008 47805008 2010010a 10210600 000010a0 c0004000 07041000 22001204 00000980 000808c0 08300000 4001b0c0 0780c88a 20210080 c1080481 0208a008 90000200 02008020 00482008 00020201 80020100 18208e30 03004040 81d49418 00004800 c0002001 00224000 90000000 04000302 0187000b 60066000 00002600 |