On Target AA2AR_HUMAN 0.4224599/CHEMBL539454
For the given ligand sinomenine, we have found in our database that, being scored 0.4224599, the most similar ligand is CHEMBL539454. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL539454 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | CCCN(CCc1ccc(NC(=O)CCC(N)C(=O)NCCCCC(NC(=O)C(CCCCNC(C)=O)NC(C)=O)C(N)=O)cc1)C1CCc2c(O)cccc2C1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00034002 43003a08 20100102 44010600 20000020 c0002000 02000000 20000209 00200880 000a08c0 08380004 4083b040 0600801a 0030a001 80020040 02042008 00040200 02000000 08002000 00020201 40100100 38240630 20006003 83500018 00000000 80000001 00000000 10000080 0c008002 0006c00b 20004000 00002600 |