On Target DRD1_HUMAN 0.5347222/CHEMBL405519
For the given ligand sinomenine, we have found in our database that, being scored 0.5347222, the most similar ligand is CHEMBL405519. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL405519 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | CCCN1CCC[C@@H]2Cc3c(ccc(O)c3O)C[C@H]21 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00000000 43000208 20100102 00010600 00000020 c0000002 02000000 20000201 00000880 000808c0 08300000 50818040 00000002 00200000 00000020 0204a008 00000200 02000000 00002000 00020201 00000100 18200010 00004000 81500010 00000000 80000001 00120000 10000000 04000002 0006c00a 00020000 00002600 |