On Target DRD5_HUMAN 0.46829268/CHEMBL3577346
For the given ligand sinomenine, we have found in our database that, being scored 0.46829268, the most similar ligand is CHEMBL3577346. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL3577346 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | CCCCn1cc(CCCOc2ccc(C(=O)NCCCCN(CCC)[C@H]3CCc4c(O)cccc4C3)cc2OC)nn1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 04000000 57001a18 6030010b 00a10718 00081020 c2000000 06042000 22001201 00200880 100808c0 08308000 40838840 0080ca86 00a02000 13014401 2a0ca00c 00000200 86000000 00482000 00060201 00020100 18268610 010050c0 8154801c 00200001 c2000001 00220000 90002000 04000306 0006c00b b0040000 0400a640 |