On Target TSHR_HUMAN 0.3649289/CHEMBL3897841
For the given ligand sinomenine, we have found in our database that, being scored 0.3649289, the most similar ligand is CHEMBL3897841. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL3897841 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | CC(=O)N1CCC(C)(c2ccccc2)C2C=C(NC(=O)OC3CCCC3)C=CC21 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00400030 09449200 0a100102 00110700 480e0000 00300001 00180000 a0000414 00000e00 001808ca 08340040 54418220 00028102 00210100 00002400 001e010c 20830000 03000142 40412880 00000201 00008900 18040e10 41008000 0050021a 00000000 80003002 00484800 90240100 10000200 010e140b ac000000 42012600 |