On Target NPY1R_HUMAN 0.43712574/CHEMBL549377
For the given ligand sinomenine, we have found in our database that, being scored 0.43712574, the most similar ligand is CHEMBL549377. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL549377 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1ccccc1[C@@H](C)N[C@@H]1CC[C@@H](C(=O)N2CCC(C(=O)N3CCCC3)(c3ccccc3)CC2)C(C)(C)C1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00030000 01001208 20100108 00010600 00001000 00000110 02000000 22001600 00200880 001808c0 08300000 50039000 0500881a 00000000 41000401 00042008 00000000 02000000 02002000 00020201 00000100 18248630 00000000 81500018 00000000 c0000000 00000000 90000000 04000300 0006000b 24062000 00802600 |