On Target CXCR4_HUMAN 0.45833334/CHEMBL2029611
For the given ligand sinomenine, we have found in our database that, being scored 0.45833334, the most similar ligand is CHEMBL2029611. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL2029611 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | C/C1=C(/C)[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc2ccc3ccccc3c2)C(=O)NCC(=O)N[C@@H]1Cc1ccc(O)cc1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00010010 0900b208 21900102 04110e00 00000000 00000000 02180040 2000240e 00200ac0 001808ca 08300000 4103b000 06029112 00212001 80000400 00140308 20000000 02000140 00012008 00021201 00000100 38250638 00008003 83500018 00200800 80000000 405a4000 90000100 0c000010 0006040b ac084000 00012600 |