On Target 5HT2C_HUMAN 0.46666667/CHEMBL155388
For the given ligand sinomenine, we have found in our database that, being scored 0.46666667, the most similar ligand is CHEMBL155388. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL155388 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1cc2c(cc1OC)C(=O)CC(CN1CCC(C(=O)c3ccc(F)cc3)CC1)C2 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00030000 43000a08 2010010b 02010600 00001000 40008012 02040000 20000001 00100800 000808c0 08300000 50019000 0400c002 20201000 01204021 22048008 00000200 02000080 00082000 00120201 00400100 18020240 00004000 00500014 00000000 80000001 00120000 10000001 00000202 0006800a 80000000 00c02600 |