On Target BKRB2_HUMAN 0.34545454/CHEMBL2105864
For the given ligand sinomenine, we have found in our database that, being scored 0.34545454, the most similar ligand is CHEMBL2105864. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL2105864 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1ccc(C[C@@H](CN[C@@H](CCCN=C(N)N)C(=O)O)NC(=O)[C@@H]2CCCN2C(=O)[C@H](CO)NC(=O)[C@H](Cc2cccs2)NC(=O)CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H]2CCCN2C(=O)[C@@H](N)CCCN=C(N)N)cc1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00050000 01007208 20100108 04010e00 00181082 00000010 02050080 2000000c 00200880 004808c2 08300210 c003b080 1600a012 0100200b 83182001 100c4008 10000802 02000008 00c04008 00020205 00000900 783c0ea0 03000083 83500018 02402801 86000004 40130000 10000204 0c000200 0006000b 38004000 00c12e10 |