On Target HRH1_HUMAN 0.4519774/CHEMBL1277125
For the given ligand sinomenine, we have found in our database that, being scored 0.4519774, the most similar ligand is CHEMBL1277125. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL1277125 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | O=C(O)C1=CCCN(C2CCC3(Cc4ccccc4Oc4ccccc43)C2)C1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00000010 09008208 2010010a 00018600 00001000 00000000 02180100 30000600 01100804 001a08c8 08340000 40019040 08008102 00210000 01000001 000c2008 60000000 02000140 00812012 00020201 00400100 18100a90 01008080 00500410 00001001 c0000400 00480000 10200000 00000302 0106c40a 04020400 02002700 |