On Target CCR2_HUMAN 0.46560848/CHEMBL3417216
For the given ligand sinomenine, we have found in our database that, being scored 0.46560848, the most similar ligand is CHEMBL3417216. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL3417216 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1ccc(OC)c2c1CCC2N[C@@H]1CC[C@@](C(=O)N2CCc3ccc(C(F)(F)F)cc3C2)(C(C)C)C1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00030008 47821208 2010010a 10010600 00001021 40000100 12000400 22001604 00200980 001808d0 08300000 40039842 0400889a 21201000 01000481 00062008 00000200 02000020 00082000 00020201 80020100 18208630 00004000 81548418 00000000 c0000000 08084100 90000000 04000300 0106c00b 24160000 02802600 |