On Target GASR_HUMAN 0.3032491/CHEMBL2153191
For the given ligand ticagrelor_Y, we have found in our database that, being scored 0.3032491, the most similar ligand is CHEMBL2153191. Check out the elaboration below.
| ticagrelor_Y (Given Ligand) | CHEMBL2153191 (Similar Ligand) |
|---|---|
| CCCSc5nc(N[C@@H]1C[C@H]1c2ccc(F)c(F)c2)c4nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c4n5 | CCCSc1nc(ccc1C(=O)NC2CCCCC2)N3CCC[C@@H](CC(=O)O)C3 |
|
|
|
|
|
|
| 0001400b a3000b18 e01001a0 0a192720 20380060 0000e014 04008100 10102902 00020900 118868c0 0930000c 50019900 04011024 038c1100 70420281 100ed00c 04a41080 06014088 99c00020 00362041 80120120 18340050 27805044 8dc80015 00202c02 90000200 90040208 100050b1 0e300208 0146800a c0001000 0d2186c0 | 10034002 01809b00 001241a0 80102610 201c1000 00202020 00004100 32101100 00020200 200040d0 01600004 70015100 1401880a 00848000 12020d00 000c400c 04060000 06014004 0a602020 00a00201 c0100000 1c048e10 21800800 0078001d 00042000 50000000 28000080 90000080 00408108 00060801 b0001000 81812a60 |