On Target OPRM_HUMAN 0.3630363/CHEMBL572393
For the given ligand ticagrelor_Y, we have found in our database that, being scored 0.3630363, the most similar ligand is CHEMBL572393. Check out the elaboration below.
| ticagrelor_Y (Given Ligand) | CHEMBL572393 (Similar Ligand) |
|---|---|
| CCCSc5nc(N[C@@H]1C[C@H]1c2ccc(F)c(F)c2)c4nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c4n5 | CCC(=O)N(C1CCN(CCc2ccccc2)CC1)c3ccc(cc3)C(C)NC(=O)[C@H]4O[C@H]([C@H](O)[C@@H]4O)c5nc6c(NC7CCCC7)ncnc6[nH]5 |
|
|
|
|
|
|
| 0001400b a3000b18 e01001a0 0a192720 20380060 0000e014 04008100 10102902 00020900 118868c0 0930000c 50019900 04011024 038c1100 70420281 100ed00c 04a41080 06014088 99c00020 00362041 80120120 18340050 27805044 8dc80015 00202c02 90000200 90040208 100050b1 0e300208 0146800a c0001000 0d2186c0 | 0005400a 01801c01 02181500 d8090620 241880e0 0000e010 01009000 22101800 10400380 010c09e0 08288004 5081d800 1400882a 01108000 000a1449 380f000c 10048000 87804000 09c02008 80600201 e0100420 182c8650 b78070c6 8950011c 10000403 c1108200 18000400 900000a1 0402830c 01c60c13 e0041000 20002ec0 |