On Target NPSR1_HUMAN 0.33333334/CHEMBL1800088
For the given ligand ticagrelor_Y, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL1800088. Check out the elaboration below.
| ticagrelor_Y (Given Ligand) | CHEMBL1800088 (Similar Ligand) |
|---|---|
| CCCSc5nc(N[C@@H]1C[C@H]1c2ccc(F)c(F)c2)c4nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c4n5 | Fc1ccc(cc1)C2(CC3CCOCC3)c4ccccc4c5nccn25 |
|
|
|
|
|
|
| 0001400b a3000b18 e01001a0 0a192720 20380060 0000e014 04008100 10102902 00020900 118868c0 0930000c 50019900 04011024 038c1100 70420281 100ed00c 04a41080 06014088 99c00020 00362041 80120120 18340050 27805044 8dc80015 00202c02 90000200 90040208 100050b1 0e300208 0146800a c0001000 0d2186c0 | 00004102 01800200 00100102 12010700 a0080060 00002010 00000400 01081000 80000900 100818c0 08108008 40018000 01001800 01a01000 008200a0 020d100c 00800000 0e002180 00482000 00500001 80100120 38008010 21005040 81500011 00000400 e0000001 00000000 50014081 06000286 0046880a 400c0800 00000600 |