On Target PTAFR_HUMAN 0.3201581/CHEMBL37358
For the given ligand ticagrelor_Y, we have found in our database that, being scored 0.3201581, the most similar ligand is CHEMBL37358. Check out the elaboration below.
| ticagrelor_Y (Given Ligand) | CHEMBL37358 (Similar Ligand) |
|---|---|
| CCCSc5nc(N[C@@H]1C[C@H]1c2ccc(F)c(F)c2)c4nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c4n5 | Cc1nc2cnccc2n1CCCOC3CCC(O3)c4ccc(F)cc4 |
|
|
|
|
|
|
| 0001400b a3000b18 e01001a0 0a192720 20380060 0000e014 04008100 10102902 00020900 118868c0 0930000c 50019900 04011024 038c1100 70420281 100ed00c 04a41080 06014088 99c00020 00362041 80120120 18340050 27805044 8dc80015 00202c02 90000200 90040208 100050b1 0e300208 0146800a c0001000 0d2186c0 | 0000004a 01800000 00104102 12010700 082c0070 0000c010 00009800 08000000 10600900 008818e0 0d10800c 40018000 00001800 00a91000 000e0080 022c100c 08a00000 02000280 10e08000 00100001 c0000120 18008070 21800041 00400010 00000400 c0002000 00088200 34000001 00000204 00468802 40480000 02000680 |