On Target GRM5_HUMAN 0.3429603/CHEMBL4072424
For the given ligand ticagrelor_Y, we have found in our database that, being scored 0.3429603, the most similar ligand is CHEMBL4072424. Check out the elaboration below.
| ticagrelor_Y (Given Ligand) | CHEMBL4072424 (Similar Ligand) |
|---|---|
| CCCSc5nc(N[C@@H]1C[C@H]1c2ccc(F)c(F)c2)c4nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c4n5 | O=C1C=C(OCCC2CC2)N=C3COC[C@@H](Cc4ccccc4)N13 |
|
|
|
|
|
|
| 0001400b a3000b18 e01001a0 0a192720 20380060 0000e014 04008100 10102902 00020900 118868c0 0930000c 50019900 04011024 038c1100 70420281 100ed00c 04a41080 06014088 99c00020 00362041 80120120 18340050 27805044 8dc80015 00202c02 90000200 90040208 100050b1 0e300208 0146800a c0001000 0d2186c0 | 04004002 09000218 ba900108 90010700 80080020 0200c000 04001800 00001008 06110b02 800a08e0 0814080c 40018000 02009084 01c80000 51021280 001e700c 40a08000 02888008 50440000 00440001 80020120 18000050 a3c03043 85700110 02000440 c0000004 20020280 10040030 14004204 0046040a d0884000 48240480 |