On Target CLTR1_HUMAN 0.28467155/CHEMBL3401686
For the given ligand ticagrelor_Y, we have found in our database that, being scored 0.28467155, the most similar ligand is CHEMBL3401686. Check out the elaboration below.
| ticagrelor_Y (Given Ligand) | CHEMBL3401686 (Similar Ligand) |
|---|---|
| CCCSc5nc(N[C@@H]1C[C@H]1c2ccc(F)c(F)c2)c4nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c4n5 | OC(=O)CCCN1CC(Oc2c(OCc3ccc(OCCCCc4ccccc4)cc3)cccc12)C(=O)O |
|
|
|
|
|
|
| 0001400b a3000b18 e01001a0 0a192720 20380060 0000e014 04008100 10102902 00020900 118868c0 0930000c 50019900 04011024 038c1100 70420281 100ed00c 04a41080 06014088 99c00020 00362041 80120120 18340050 27805044 8dc80015 00202c02 90000200 90040208 100050b1 0e300208 0146800a c0001000 0d2186c0 | 04026002 81000008 2010110a 00210702 a0181080 06006000 02040000 20000000 00060920 000808c0 08340004 5001d000 0c80c002 08210000 112a1041 0208e008 10840080 82000000 08c00010 00022601 41100100 18040a20 37400080 08c09010 00001001 80002000 28420008 10800081 00008200 0006000a 40000400 00822f80 |