On Target CXCR1_HUMAN 0.25945947/CHEMBL3906175
For the given ligand ticagrelor_Y, we have found in our database that, being scored 0.25945947, the most similar ligand is CHEMBL3906175. Check out the elaboration below.
| ticagrelor_Y (Given Ligand) | CHEMBL3906175 (Similar Ligand) |
|---|---|
| CCCSc5nc(N[C@@H]1C[C@H]1c2ccc(F)c(F)c2)c4nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c4n5 | CCOC(=O)[C@@H]1CCCN1C(=O)c2cccc(NC3=C(NC(C4CCCS4)c5oc(C)cc5)C(=O)C3=O)c2F |
|
|
|
|
|
|
| 0001400b a3000b18 e01001a0 0a192720 20380060 0000e014 04008100 10102902 00020900 118868c0 0930000c 50019900 04011024 038c1100 70420281 100ed00c 04a41080 06014088 99c00020 00362041 80120120 18340050 27805044 8dc80015 00202c02 90000200 90040208 100050b1 0e300208 0146800a c0001000 0d2186c0 | 1041c08a c3205800 e0180302 8a112700 24090081 08002818 800002a0 222d1500 05e04d40 071b48d0 00380034 5043b880 ce098c5f 41241008 800a9468 100811c8 16874601 22008c00 0863aa30 26000241 40100da0 18168e00 33000300 2658001c 04841430 c0000280 04d04010 9c0c0581 60588302 a006c023 a4045024 43012600 |