On Target NPFF1_HUMAN 0.24731183/CHEMBL2208301
For the given ligand ticagrelor_Y, we have found in our database that, being scored 0.24731183, the most similar ligand is CHEMBL2208301. Check out the elaboration below.
| ticagrelor_Y (Given Ligand) | CHEMBL2208301 (Similar Ligand) |
|---|---|
| CCCSc5nc(N[C@@H]1C[C@H]1c2ccc(F)c(F)c2)c4nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c4n5 | NC(=N)NCCC[C@H](NC(=O)CCN1c2ccccc2Sc3ccccc13)C(=O)N[C@@H](Cc4ccccc4)C(=O)N |
|
|
|
|
|
|
| 0001400b a3000b18 e01001a0 0a192720 20380060 0000e014 04008100 10102902 00020900 118868c0 0930000c 50019900 04011024 038c1100 70420281 100ed00c 04a41080 06014088 99c00020 00362041 80120120 18340050 27805044 8dc80015 00202c02 90000200 90040208 100050b1 0e300208 0146800a c0001000 0d2186c0 | 00014002 01803600 00120100 04110e00 20040000 00002000 00000010 2000200c 00202a80 000809e2 08304004 7003b000 0e009012 00002001 a0020040 00100002 04041000 22000000 0820001a 02000201 e0100100 38250620 20800003 83580019 00004800 80000100 42200010 10000080 0c008210 0106001b a008e000 00012620 |