On Target OPRD_HUMAN 0.32539684/CHEMBL463518
For the given ligand ticagrelor_Y, we have found in our database that, being scored 0.32539684, the most similar ligand is CHEMBL463518. Check out the elaboration below.
| ticagrelor_Y (Given Ligand) | CHEMBL463518 (Similar Ligand) |
|---|---|
| CCCSc5nc(N[C@@H]1C[C@H]1c2ccc(F)c(F)c2)c4nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c4n5 | C[C@H]1C2Cc3cc4ncnc(NCCc5ccc(cc5)c6ccccc6)c4cc3[C@@]1(C)CCN2CC7CC7 |
|
|
|
|
|
|
| 0001400b a3000b18 e01001a0 0a192720 20380060 0000e014 04008100 10102902 00020900 118868c0 0930000c 50019900 04011024 038c1100 70420281 100ed00c 04a41080 06014088 99c00020 00362041 80120120 18340050 27805044 8dc80015 00202c02 90000200 90040208 100050b1 0e300208 0146800a c0001000 0d2186c0 | 00016002 01004a00 00100102 480d0600 20040020 00004002 00008000 20100801 00000980 000808c0 09300004 50819800 1c000002 01608000 00020060 020c0004 00060200 02004004 0c602000 10200201 40100100 18240038 30804040 81500011 00002000 80000001 00000040 100000c0 0440c00a 0046000a 40021000 000026e0 |