On Target CCR2_HUMAN 0.32580644/CHEMBL2338390
For the given ligand ticagrelor_Y, we have found in our database that, being scored 0.32580644, the most similar ligand is CHEMBL2338390. Check out the elaboration below.
| ticagrelor_Y (Given Ligand) | CHEMBL2338390 (Similar Ligand) |
|---|---|
| CCCSc5nc(N[C@@H]1C[C@H]1c2ccc(F)c(F)c2)c4nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c4n5 | CO[C@@H]1COCC[C@@H]1NC2CCN(CC2)C(=O)c3nc(nc(N4CCc5cc(ccc5C4)C(F)(F)F)c3C)C(F)(F)F |
|
|
|
|
|
|
| 0001400b a3000b18 e01001a0 0a192720 20380060 0000e014 04008100 10102902 00020900 118868c0 0930000c 50019900 04011024 038c1100 70420281 100ed00c 04a41080 06014088 99c00020 00362041 80120120 18340050 27805044 8dc80015 00202c02 90000200 90040208 100050b1 0e300208 0146800a c0001000 0d2186c0 | 1001000a 01011c00 40102100 180d0f10 a12810a1 0810c042 00009400 2a103845 10802180 400809f0 0c292004 5001d802 84008882 01388000 001a1400 100c800e 10240a08 02004022 90c00000 40200201 00120021 182da600 378140c0 89540d1d 00044401 c0000480 00004110 900010b1 2400030c 00460013 e0149020 200026e0 |