On Target EDNRA_HUMAN 0.42857143/CHEMBL266277
For the given ligand C64, we have found in our database that, being scored 0.42857143, the most similar ligand is CHEMBL266277. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL266277 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CN(C)c1cccc2c(cccc12)S(=O)(=O)Nc3ccc(Br)nc3 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00004012 0080a004 01004006 00b00620 00040010 00000000 40800000 00401008 00000000 000008c0 00202004 20008000 00140c10 00000021 80280040 00060004 00042000 00000408 08600004 00006000 c0000000 08008808 20840040 08400008 00000080 00000000 00220000 000200cc 00008400 204e0000 00000008 180100e0 |