On Target ACM5_HUMAN 0.5/CHEMBL3329736
For the given ligand C64, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL3329736. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL3329736 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CCN([C@H](C)c1ccccc1)C(=O)C2CCN(CC2)S(=O)(=O)c3ccc(OC)cc3 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00020010 03804008 21100108 01b10600 00081000 00000000 02000000 22001000 00200000 004808c0 08202000 70039000 04008802 00000001 81600401 00000008 00002000 02000000 00400800 00026601 80000000 18008600 00000000 18400018 02000000 c0000004 00800000 9000008c 00000700 20060203 20040000 00810670 |