On Target GASR_HUMAN 0.43930635/CHEMBL215416
For the given ligand C64, we have found in our database that, being scored 0.43930635, the most similar ligand is CHEMBL215416. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL215416 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | Brc1ccc(C(=O)N2CCOCC2)c(NS(=O)(=O)c3cccc4nccnc34)c1 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 0088405a 0188c800 01100902 91b10600 000400c0 00110002 00018000 02001000 80000000 001018c0 00302005 62008000 00048c13 80400001 83ae1448 000e010c 18022010 02000802 00600000 04006000 e0001000 0802ae00 33840040 1840001c 00200480 c0000000 40928000 8000000d 00000710 20060001 80040088 48010360 |