On Target NPSR1_HUMAN 0.25641027/CHEMBL1289780
For the given ligand C64, we have found in our database that, being scored 0.25641027, the most similar ligand is CHEMBL1289780. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL1289780 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | O=C(Nc1ccccc1C(=O)N2CCCCC2)c3cccc(c3)c4ccccc4 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 10006002 01001800 00100100 00010600 00000001 04110040 10000000 22081000 00800000 200008c0 00280044 5001c000 00008802 00100000 00020440 08000008 00060000 03001002 0c000000 00800201 40100000 18068600 30012000 0054001c 00000000 c0000000 08000010 900010c1 1000c100 00060001 a0040000 40000200 |