On Target TAAR1_HUMAN 0.48175183/CHEMBL1558546
For the given ligand C64, we have found in our database that, being scored 0.48175183, the most similar ligand is CHEMBL1558546. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL1558546 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | COc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)C(C)C)cc2)cc1 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00000016 00802008 2110000a 00b00e00 00001010 00000000 02000004 20002009 00000400 00000840 00202004 60009000 00049402 00000001 81280061 00020008 00042000 00400800 08400000 00026a01 c0040100 18010e00 20060040 09400018 00110088 00000000 00040000 000000cc 00208600 20060001 00000000 00014268 |