On Target DRD2_HUMAN 0.5322581/CHEMBL231326
For the given ligand C64, we have found in our database that, being scored 0.5322581, the most similar ligand is CHEMBL231326. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL231326 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CCCCc1ccc(cc1)S(=O)(=O)Nc2ccc3CNCc3c2 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 10000012 01801800 01000102 90b10600 00000008 00000000 00000000 02001000 00800800 00080840 08302004 60008000 00040c02 00200001 80281440 00020000 00002000 02000000 00400000 00006001 c0000100 08048800 20040040 08400018 00040080 c0200000 00000000 8000002c 00400502 20060006 00040000 00010660 |