On Target 5HT5A_HUMAN 0.38509318/CHEMBL538029
For the given ligand C64, we have found in our database that, being scored 0.38509318, the most similar ligand is CHEMBL538029. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL538029 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | Cl.Clc1ccc(OC2CCN(CC[C@H]3CCCN3S(=O)(=O)c4ccc5cc[nH]c5c4)CC2)cc1 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 04008052 01800408 21100108 01b10600 000c1000 02000010 02010000 20000000 00000000 004009e0 00202004 70018800 02800807 00400001 81e00041 000c200c 00202010 00000400 00e02000 00027603 e0000000 18008118 21800080 98500018 02002001 0000000c 00100000 1000000c 00000600 20060010 00040200 00032270 |