On Target AA1R_HUMAN 0.36363637/CHEMBL1170137
For the given ligand C64, we have found in our database that, being scored 0.36363637, the most similar ligand is CHEMBL1170137. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL1170137 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CCN(C(=O)C)c1ccc(OC)c2nc(NC(=O)c3ccc(NS(=O)(=O)C)cc3)sc12 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00034082 10080808 6008010a 81310600 000c1008 00808404 83008100 12029118 00400100 21009842 00382a04 d0048400 08008c32 0a500003 810820cb 001e040c 00040000 02004080 08200012 00a24000 40100000 4c068e80 60806800 0261001c 00000080 8c200180 40040080 90000c8c 00008308 080e2801 80041000 04414760 |