On Target ADA2B_HUMAN 0.31410256/CHEMBL346389
For the given ligand C64, we have found in our database that, being scored 0.31410256, the most similar ligand is CHEMBL346389. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL346389 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | Clc1ccc(cc1)N2CCN(Cc3ccc4NC(=O)COc4c3)CC2 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 0400e002 44000808 20001128 84010602 80001080 00000000 02000000 02001000 00020000 00010a40 002c0004 4000c800 02808806 0010a080 01001441 00084408 00040000 82000000 08080000 00020200 41100000 28048700 32002020 02448002 00002000 c0000000 28080048 80000080 08008300 00060001 00040000 02020200 |