On Target NPBW1_HUMAN 0.2636816/CHEMBL1940354
For the given ligand C64, we have found in our database that, being scored 0.2636816, the most similar ligand is CHEMBL1940354. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL1940354 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | COc1ccc(cc1)[C@@H](C)N[C@@H]2CC[C@@H]([C@H](C2)c3ccsc3)C(=O)N4CCN(CC4)c5ccc(Cl)cn5 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 0005c002 01002208 2010492a 85010600 00141000 00000000 02040000 22001008 00000800 20080ac0 08300204 40019880 0600881a 00203001 01001401 0014000c 00040000 02004000 0a202008 00a24601 40100000 7e8087b0 20800821 3270001a 00004800 c4000200 003a0080 90000084 0800831a 0006080b 20069000 02c30e00 |