On Target ACM3_HUMAN 0.53571427/CHEMBL494778
For the given ligand C64, we have found in our database that, being scored 0.53571427, the most similar ligand is CHEMBL494778. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL494778 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | O=S(=O)(NCc1cccc(c1)c2cccc(CN3CCNCC3)c2)c4ccc5OCOc5c4 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00002010 00804008 21080108 05b10600 00081401 04040000 16000001 02041000 00200000 00011840 40302000 60008000 00004803 10002001 81200601 00208008 000a2000 02101000 04480800 00026000 80040200 28008000 10000020 0a410008 42000000 c0080004 48800000 a00000cd 09004700 20060000 00040000 00010360 |