On Target 5HT1E_HUMAN 0.3915344/CHEMBL29410
For the given ligand C64, we have found in our database that, being scored 0.3915344, the most similar ligand is CHEMBL29410. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL29410 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | COc1ccc(NS(=O)(=O)c2sc3ccc(Cl)cc3c2C)cc1N4CCN5CCCCC5C4 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 0001c012 11800008 21100b2a 04b90600 a0181000 00402010 06020000 20000008 00000040 00408ac0 04202204 70018880 0204160e 00022001 813a11c1 00024408 00042088 02002400 08c02000 00026201 c0100000 78000998 200400e1 0b50821a 00882080 a4102000 20040400 1001008c 08808604 20060000 00000c00 00c30660 |